ChemNet > CAS > 261762-83-8 2-Chloro-6-fluoro-3-methylbenzyl alcohol
261762-83-8 2-Chloro-6-fluoro-3-methylbenzyl alcohol
| Ürün Adı |
2-Chloro-6-fluoro-3-methylbenzyl alcohol |
| Eş anlamlı |
(2-chloro-6-fluoro-3-methylphenyl)methanol |
| Moleküler Formülü |
C8H8ClFO |
| Molekül Ağırlığı |
174.5999 |
| InChI |
InChI=1/C8H8ClFO/c1-5-2-3-7(10)6(4-11)8(5)9/h2-3,11H,4H2,1H3 |
| CAS kayıt numarası |
261762-83-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.286g/cm3 |
| Kaynama noktası |
245.7°C at 760 mmHg |
| Kırılma indisi |
1.537 |
| Alevlenme noktası |
102.4°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
